C18H22N6O2 — CID 123960746
3-[[1-[4-(dimethylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one (PubChem CID 123960746) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[[1-[4-(dimethylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[1-[4-(dimethylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123960746 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[[1-[4-(dimethylamino)but-2-enoyl]azetidin-3-yl]amino]-5-pyrimidin-4-yl-1H-pyridin-2-one |
| SMILES | CN(C)CC=CC(=O)N1CC(Nc2cc(-c3ccncn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C18H22N6O2/c1-23(2)7-3-4-17(25)24-10-14(11-24)22-16-8-13(9-20-18(16)26)15-5-6-19-12-21-15/h3-6,8-9,12,14,22H,7,10-11H2,1-2H3,(H,20,26) |
| InChIKey | JFLMEHCSBCCWHU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|