C22H29N5O3 — CID 118250764
3-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one (PubChem CID 118250764) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118250764 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
| SMILES | COc1cc(-c2c[nH]c(=O)c(NC3CCCN(C(=O)/C=C/CN(C)C)C3)c2)ccn1 |
| InChI | InChI=1S/C22H29N5O3/c1-26(2)10-5-7-21(28)27-11-4-6-18(15-27)25-19-12-17(14-24-22(19)29)16-8-9-23-20(13-16)30-3/h5,7-9,12-14,18,25H,4,6,10-11,15H2,1-3H3,(H,24,29)/b7-5+ |
| InChIKey | ANFCYMXXUIJGFX-FNORWQNLSA-N |
| XLogP | 1.97 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|