C23H29N5O2 — CID 118251363
5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one (PubChem CID 118251363) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251363 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one |
| SMILES | O=C(/C=C/CN1CCCC1)N1CCC[C@@H](Nc2cc(-c3ccncc3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C23H29N5O2/c29-22(6-4-13-27-11-1-2-12-27)28-14-3-5-20(17-28)26-21-15-19(16-25-23(21)30)18-7-9-24-10-8-18/h4,6-10,15-16,20,26H,1-3,5,11-14,17H2,(H,25,30)/b6-4+/t20-/m1/s1 |
| InChIKey | YTPGUWKRRGOWGM-PEAOBZDDSA-N |
| XLogP | 2.49 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|