C24H25N5O2 — CID 118251027
5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one (PubChem CID 118251027) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251027 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-pyridin-4-yl-3-[[(3R)-1-[(E)-4-pyridin-2-ylbut-2-enoyl]piperidin-3-yl]amino]-1H-pyridin-2-one |
| SMILES | O=C(/C=C/Cc1ccccn1)N1CCC[C@@H](Nc2cc(-c3ccncc3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C24H25N5O2/c30-23(8-3-6-20-5-1-2-11-26-20)29-14-4-7-21(17-29)28-22-15-19(16-27-24(22)31)18-9-12-25-13-10-18/h1-3,5,8-13,15-16,21,28H,4,6-7,14,17H2,(H,27,31)/b8-3+/t21-/m1/s1 |
| InChIKey | YWPXJCWDWYDYGI-RPZUPEABSA-N |
| XLogP | 3.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|