C23H31N5O3 — CID 123765150
3-[ethyl-[1-[4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one (PubChem CID 123765150) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[ethyl-[1-[4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one.
| Compound Name | 3-[ethyl-[1-[4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123765150 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 3-[ethyl-[1-[4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]-5-(2-methoxy-4-pyridinyl)-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccnc(OC)c2)c[nH]c1=O)C1CCCN(C(=O)C=CCNC)C1 |
| InChI | InChI=1S/C23H31N5O3/c1-4-28(19-7-6-12-27(16-19)22(29)8-5-10-24-2)20-13-18(15-26-23(20)30)17-9-11-25-21(14-17)31-3/h5,8-9,11,13-15,19,24H,4,6-7,10,12,16H2,1-3H3,(H,26,30) |
| InChIKey | SAKIVMHOSKKLQL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|