C25H35N5O2 — CID 158352359
3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-(2-ethyl-4-pyridinyl)-1H-pyridin-2-one (PubChem CID 158352359) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-(2-ethyl-4-pyridinyl)-1H-pyridin-2-one.
| Compound Name | 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-(2-ethyl-4-pyridinyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 158352359 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-(2-ethyl-4-pyridinyl)-1H-pyridin-2-one |
| SMILES | CCc1cc(-c2c[nH]c(=O)c(N(CC)[C@H]3CCCN(C(=O)/C=C/CN(C)C)C3)c2)ccn1 |
| InChI | InChI=1S/C25H35N5O2/c1-5-21-15-19(11-12-26-21)20-16-23(25(32)27-17-20)30(6-2)22-9-7-14-29(18-22)24(31)10-8-13-28(3)4/h8,10-12,15-17,22H,5-7,9,13-14,18H2,1-4H3,(H,27,32)/b10-8+/t22-/m0/s1 |
| InChIKey | GSLYCPUWHRJDRR-RCHCNPRSSA-N |
| XLogP | 2.93 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|