C23H29N5O2 — CID 118250783
3-[[(3S)-1-[(E)-4-aminobut-2-enoyl]piperidin-3-yl]-(cyclopropylmethyl)amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118250783) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[[(3S)-1-[(E)-4-aminobut-2-enoyl]piperidin-3-yl]-(cyclopropylmethyl)amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[(3S)-1-[(E)-4-aminobut-2-enoyl]piperidin-3-yl]-(cyclopropylmethyl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118250783 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[[(3S)-1-[(E)-4-aminobut-2-enoyl]piperidin-3-yl]-(cyclopropylmethyl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | NC/C=C/C(=O)N1CCC[C@H](N(CC2CC2)c2cc(-c3ccncc3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C23H29N5O2/c24-9-1-4-22(29)27-12-2-3-20(16-27)28(15-17-5-6-17)21-13-19(14-26-23(21)30)18-7-10-25-11-8-18/h1,4,7-8,10-11,13-14,17,20H,2-3,5-6,9,12,15-16,24H2,(H,26,30)/b4-1+/t20-/m0/s1 |
| InChIKey | AZADOMHKENFIAM-DFKDPWMTSA-N |
| XLogP | 2.16 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|