C23H31N5O2 — CID 118251264
3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118251264) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251264 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 3-[[(3S)-1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccncc2)c[nH]c1=O)[C@H]1CCCN(C(=O)/C=C/CN(C)C)C1 |
| InChI | InChI=1S/C23H31N5O2/c1-4-28(20-7-5-14-27(17-20)22(29)8-6-13-26(2)3)21-15-19(16-25-23(21)30)18-9-11-24-12-10-18/h6,8-12,15-16,20H,4-5,7,13-14,17H2,1-3H3,(H,25,30)/b8-6+/t20-/m0/s1 |
| InChIKey | SRGUZQVFEOFWCX-IEJURRBGSA-N |
| XLogP | 2.37 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|