C21H28N6O2 — CID 118251421
3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]-ethylamino]-5-[2-(methylamino)-4-pyridinyl]-1H-pyridin-2-one (PubChem CID 118251421) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]-ethylamino]-5-[2-(methylamino)-4-pyridinyl]-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]-ethylamino]-5-[2-(methylamino)-4-pyridinyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251421 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[[1-[(E)-4-aminobut-2-enoyl]pyrrolidin-3-yl]-ethylamino]-5-[2-(methylamino)-4-pyridinyl]-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccnc(NC)c2)c[nH]c1=O)C1CCN(C(=O)/C=C/CN)C1 |
| InChI | InChI=1S/C21H28N6O2/c1-3-27(17-7-10-26(14-17)20(28)5-4-8-22)18-11-16(13-25-21(18)29)15-6-9-24-19(12-15)23-2/h4-6,9,11-13,17H,3,7-8,10,14,22H2,1-2H3,(H,23,24)(H,25,29)/b5-4+ |
| InChIKey | DJVWMKNWRWDSEA-SNAWJCMRSA-N |
| XLogP | 1.42 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|