C21H27N5O2 — CID 123141950
3-[[(3R)-1-(4-aminobut-2-enoyl)piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 123141950) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[[(3R)-1-(4-aminobut-2-enoyl)piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[(3R)-1-(4-aminobut-2-enoyl)piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123141950 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[[(3R)-1-(4-aminobut-2-enoyl)piperidin-3-yl]-ethylamino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccncc2)c[nH]c1=O)[C@@H]1CCCN(C(=O)C=CCN)C1 |
| InChI | InChI=1S/C21H27N5O2/c1-2-26(18-5-4-12-25(15-18)20(27)6-3-9-22)19-13-17(14-24-21(19)28)16-7-10-23-11-8-16/h3,6-8,10-11,13-14,18H,2,4-5,9,12,15,22H2,1H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | SNLMOARMGQTLGV-GOSISDBHSA-N |
| XLogP | 1.77 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|