C20H24N4O2 — CID 118250925
3-[ethyl-(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118250925) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-[ethyl-(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[ethyl-(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118250925 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-[ethyl-(1-prop-2-enoylpiperidin-4-yl)amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(N(CC)c2cc(-c3ccncc3)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C20H24N4O2/c1-3-19(25)23-11-7-17(8-12-23)24(4-2)18-13-16(14-22-20(18)26)15-5-9-21-10-6-15/h3,5-6,9-10,13-14,17H,1,4,7-8,11-12H2,2H3,(H,22,26) |
| InChIKey | COYSESRYIUQVJY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|