C21H27N5O2 — CID 123612260
3-[ethyl-[(3S)-1-[4-(methylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 123612260) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[ethyl-[(3S)-1-[4-(methylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[ethyl-[(3S)-1-[4-(methylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123612260 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[ethyl-[(3S)-1-[4-(methylamino)but-2-enoyl]pyrrolidin-3-yl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccncc2)c[nH]c1=O)[C@H]1CCN(C(=O)C=CCNC)C1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-26(18-8-12-25(15-18)20(27)5-4-9-22-2)19-13-17(14-24-21(19)28)16-6-10-23-11-7-16/h4-7,10-11,13-14,18,22H,3,8-9,12,15H2,1-2H3,(H,24,28)/t18-/m0/s1 |
| InChIKey | MZDFCXKXXLTOKH-SFHVURJKSA-N |
| XLogP | 1.64 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|