C20H25N5O2 — CID 118251466
5-[2-(methylamino)-4-pyridinyl]-3-[methyl-(1-prop-2-enoylpiperidin-4-yl)amino]-1H-pyridin-2-one (PubChem CID 118251466) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[2-(methylamino)-4-pyridinyl]-3-[methyl-(1-prop-2-enoylpiperidin-4-yl)amino]-1H-pyridin-2-one.
| Compound Name | 5-[2-(methylamino)-4-pyridinyl]-3-[methyl-(1-prop-2-enoylpiperidin-4-yl)amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251466 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-[2-(methylamino)-4-pyridinyl]-3-[methyl-(1-prop-2-enoylpiperidin-4-yl)amino]-1H-pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(N(C)c2cc(-c3ccnc(NC)c3)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C20H25N5O2/c1-4-19(26)25-9-6-16(7-10-25)24(3)17-11-15(13-23-20(17)27)14-5-8-22-18(12-14)21-2/h4-5,8,11-13,16H,1,6-7,9-10H2,2-3H3,(H,21,22)(H,23,27) |
| InChIKey | SKFQRRWNIYQKDH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|