C20H24N6O2 — CID 118251024
3-[cyclopropylmethyl-(1-prop-2-enoylazetidin-3-yl)amino]-5-[6-(methylamino)pyrimidin-4-yl]-1H-pyridin-2-one (PubChem CID 118251024) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-(1-prop-2-enoylazetidin-3-yl)amino]-5-[6-(methylamino)pyrimidin-4-yl]-1H-pyridin-2-one.
| Compound Name | 3-[cyclopropylmethyl-(1-prop-2-enoylazetidin-3-yl)amino]-5-[6-(methylamino)pyrimidin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251024 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-[cyclopropylmethyl-(1-prop-2-enoylazetidin-3-yl)amino]-5-[6-(methylamino)pyrimidin-4-yl]-1H-pyridin-2-one |
| SMILES | C=CC(=O)N1CC(N(CC2CC2)c2cc(-c3cc(NC)ncn3)c[nH]c2=O)C1 |
| InChI | InChI=1S/C20H24N6O2/c1-3-19(27)25-10-15(11-25)26(9-13-4-5-13)17-6-14(8-22-20(17)28)16-7-18(21-2)24-12-23-16/h3,6-8,12-13,15H,1,4-5,9-11H2,2H3,(H,22,28)(H,21,23,24) |
| InChIKey | PYCJDFYWHMGOFE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|