C20H26N6O3 — CID 118251290
5-(6-methoxypyrimidin-4-yl)-3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-1H-pyridin-2-one (PubChem CID 118251290) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 5-(6-methoxypyrimidin-4-yl)-3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-(6-methoxypyrimidin-4-yl)-3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251290 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 5-(6-methoxypyrimidin-4-yl)-3-[[1-[(E)-4-(propan-2-ylamino)but-2-enoyl]azetidin-3-yl]amino]-1H-pyridin-2-one |
| SMILES | COc1cc(-c2c[nH]c(=O)c(NC3CN(C(=O)/C=C/CNC(C)C)C3)c2)ncn1 |
| InChI | InChI=1S/C20H26N6O3/c1-13(2)21-6-4-5-19(27)26-10-15(11-26)25-17-7-14(9-22-20(17)28)16-8-18(29-3)24-12-23-16/h4-5,7-9,12-13,15,21,25H,6,10-11H2,1-3H3,(H,22,28)/b5-4+ |
| InChIKey | RHTXUOXRALHISP-SNAWJCMRSA-N |
| XLogP | 1.02 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|