C18H22N6O3 — CID 123163588
3-[[1-(4-aminobut-2-enoyl)azetidin-3-yl]-methylamino]-5-(6-methoxypyrimidin-4-yl)-1H-pyridin-2-one (PubChem CID 123163588) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[[1-(4-aminobut-2-enoyl)azetidin-3-yl]-methylamino]-5-(6-methoxypyrimidin-4-yl)-1H-pyridin-2-one.
| Compound Name | 3-[[1-(4-aminobut-2-enoyl)azetidin-3-yl]-methylamino]-5-(6-methoxypyrimidin-4-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123163588 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-[[1-(4-aminobut-2-enoyl)azetidin-3-yl]-methylamino]-5-(6-methoxypyrimidin-4-yl)-1H-pyridin-2-one |
| SMILES | COc1cc(-c2c[nH]c(=O)c(N(C)C3CN(C(=O)C=CCN)C3)c2)ncn1 |
| InChI | InChI=1S/C18H22N6O3/c1-23(13-9-24(10-13)17(25)4-3-5-19)15-6-12(8-20-18(15)26)14-7-16(27-2)22-11-21-14/h3-4,6-8,11,13H,5,9-10,19H2,1-2H3,(H,20,26) |
| InChIKey | GWWGEFRLUIPIMB-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|