C18H22N6O3 — CID 118251314
3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-methylamino]-5-(2-methoxypyrimidin-4-yl)-1H-pyridin-2-one (PubChem CID 118251314) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-methylamino]-5-(2-methoxypyrimidin-4-yl)-1H-pyridin-2-one.
| Compound Name | 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-methylamino]-5-(2-methoxypyrimidin-4-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251314 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-methylamino]-5-(2-methoxypyrimidin-4-yl)-1H-pyridin-2-one |
| SMILES | COc1nccc(-c2c[nH]c(=O)c(N(C)C3CN(C(=O)/C=C/CN)C3)c2)n1 |
| InChI | InChI=1S/C18H22N6O3/c1-23(13-10-24(11-13)16(25)4-3-6-19)15-8-12(9-21-17(15)26)14-5-7-20-18(22-14)27-2/h3-5,7-9,13H,6,10-11,19H2,1-2H3,(H,21,26)/b4-3+ |
| InChIKey | PJDMMFXQTICAPC-ONEGZZNKSA-N |
| XLogP | 0.00 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|