C21H25N5O2 — CID 118386530
3-[[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-cyclopropylmethyl]amino]-5-pyridin-2-yl-1H-pyridin-2-one (PubChem CID 118386530) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-cyclopropylmethyl]amino]-5-pyridin-2-yl-1H-pyridin-2-one.
| Compound Name | 3-[[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-cyclopropylmethyl]amino]-5-pyridin-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118386530 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[[[1-[(E)-4-aminobut-2-enoyl]azetidin-3-yl]-cyclopropylmethyl]amino]-5-pyridin-2-yl-1H-pyridin-2-one |
| SMILES | NC/C=C/C(=O)N1CC(C(Nc2cc(-c3ccccn3)c[nH]c2=O)C2CC2)C1 |
| InChI | InChI=1S/C21H25N5O2/c22-8-3-5-19(27)26-12-16(13-26)20(14-6-7-14)25-18-10-15(11-24-21(18)28)17-4-1-2-9-23-17/h1-5,9-11,14,16,20,25H,6-8,12-13,22H2,(H,24,28)/b5-3+ |
| InChIKey | MKMAJEAZDYXHAX-HWKANZROSA-N |
| XLogP | 1.60 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|