C23H29N5O2 — CID 118251286
3-[[[1-[(E)-4-aminobut-2-enoyl]piperidin-4-yl]-cyclopropylmethyl]amino]-5-pyridin-4-yl-1H-pyridin-2-one (PubChem CID 118251286) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[[[1-[(E)-4-aminobut-2-enoyl]piperidin-4-yl]-cyclopropylmethyl]amino]-5-pyridin-4-yl-1H-pyridin-2-one.
| Compound Name | 3-[[[1-[(E)-4-aminobut-2-enoyl]piperidin-4-yl]-cyclopropylmethyl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118251286 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[[[1-[(E)-4-aminobut-2-enoyl]piperidin-4-yl]-cyclopropylmethyl]amino]-5-pyridin-4-yl-1H-pyridin-2-one |
| SMILES | NC/C=C/C(=O)N1CCC(C(Nc2cc(-c3ccncc3)c[nH]c2=O)C2CC2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c24-9-1-2-21(29)28-12-7-18(8-13-28)22(17-3-4-17)27-20-14-19(15-26-23(20)30)16-5-10-25-11-6-16/h1-2,5-6,10-11,14-15,17-18,22,27H,3-4,7-9,12-13,24H2,(H,26,30)/b2-1+ |
| InChIKey | MCYLCBIZGWZWTK-OWOJBTEDSA-N |
| XLogP | 2.38 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|