C19H33N3O4 — CID 171147093
N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-N-methyl-4-morpholin-4-ylbut-2-enamide (PubChem CID 171147093) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-N-methyl-4-morpholin-4-ylbut-2-enamide.
| Compound Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-N-methyl-4-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 171147093 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-N-methyl-4-morpholin-4-ylbut-2-enamide |
| SMILES | CN(C(=O)C=CCN1CCOCC1)[C@@H]1CCC[C@@H](N2CCOCC2)[C@@H]1O |
| InChI | InChI=1S/C19H33N3O4/c1-20(18(23)6-3-7-21-8-12-25-13-9-21)16-4-2-5-17(19(16)24)22-10-14-26-15-11-22/h3,6,16-17,19,24H,2,4-5,7-15H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | BQEQNTDTWRIPFF-ZHALLVOQSA-N |
| XLogP | -0.05 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|