C17H26N4O3 — CID 171147140
N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-(1H-imidazol-5-yl)-N-methylprop-2-enamide (PubChem CID 171147140) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-(1H-imidazol-5-yl)-N-methylprop-2-enamide.
| Compound Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-(1H-imidazol-5-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 171147140 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[(1R,2S,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-(1H-imidazol-5-yl)-N-methylprop-2-enamide |
| SMILES | CN(C(=O)C=Cc1cnc[nH]1)[C@@H]1CCC[C@@H](N2CCOCC2)[C@@H]1O |
| InChI | InChI=1S/C17H26N4O3/c1-20(16(22)6-5-13-11-18-12-19-13)14-3-2-4-15(17(14)23)21-7-9-24-10-8-21/h5-6,11-12,14-15,17,23H,2-4,7-10H2,1H3,(H,18,19)/t14-,15-,17-/m1/s1 |
| InChIKey | FWBLZQCPXAJWDY-BFYDXBDKSA-N |
| XLogP | 0.50 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|