C6H6N2O2 — CID 1178
3-(1H-imidazol-5-yl)prop-2-enoic acid (PubChem CID 1178) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)prop-2-enoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 1178 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 3-(1H-imidazol-5-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc[nH]1 |
| InChI | InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10) |
| InChIKey | LOIYMIARKYCTBW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|