C8H11N3O — CID 25129634
(E)-N-ethyl-3-(1H-imidazol-5-yl)prop-2-enamide (PubChem CID 25129634) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is (E)-N-ethyl-3-(1H-imidazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-ethyl-3-(1H-imidazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 25129634 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (E)-N-ethyl-3-(1H-imidazol-5-yl)prop-2-enamide |
| SMILES | CCNC(=O)/C=C/c1cnc[nH]1 |
| InChI | InChI=1S/C8H11N3O/c1-2-10-8(12)4-3-7-5-9-6-11-7/h3-6H,2H2,1H3,(H,9,11)(H,10,12)/b4-3+ |
| InChIKey | WZRGXWWOSLLPHF-ONEGZZNKSA-N |
| XLogP | 0.56 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|