C7H9N3O — CID 91343948
3-(1H-imidazol-5-yl)-N-methylprop-2-enamide (PubChem CID 91343948) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-N-methylprop-2-enamide.
| Compound Name | 3-(1H-imidazol-5-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 91343948 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-N-methylprop-2-enamide |
| SMILES | CNC(=O)C=Cc1cnc[nH]1 |
| InChI | InChI=1S/C7H9N3O/c1-8-7(11)3-2-6-4-9-5-10-6/h2-5H,1H3,(H,8,11)(H,9,10) |
| InChIKey | XPLUVVHVBQZZII-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|