C9H10MnN2O5 — CID 67331289
2-hydroxypropanoate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) (PubChem CID 67331289) has the molecular formula C9H10MnN2O5 and a molecular weight of 281.13 g/mol. Its IUPAC name is 2-hydroxypropanoate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+).
| Compound Name | 2-hydroxypropanoate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) |
|---|---|
| PubChem CID | 67331289 |
| Molecular Formula | C9H10MnN2O5 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-hydroxypropanoate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) |
| SMILES | CC(O)C(=O)[O-].O=C([O-])C=Cc1cnc[nH]1.[Mn+2] |
| InChI | InChI=1S/C6H6N2O2.C3H6O3.Mn/c9-6(10)2-1-5-3-7-4-8-5;1-2(4)3(5)6;/h1-4H,(H,7,8)(H,9,10);2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | KFVLMRSEGCHHQF-UHFFFAOYSA-L |
| XLogP | -2.71 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|