C13H10MnN2O5 — CID 67332350
2-carboxyphenolate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) (PubChem CID 67332350) has the molecular formula C13H10MnN2O5 and a molecular weight of 329.17 g/mol. Its IUPAC name is 2-carboxyphenolate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+).
| Compound Name | 2-carboxyphenolate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) |
|---|---|
| PubChem CID | 67332350 |
| Molecular Formula | C13H10MnN2O5 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-carboxyphenolate;3-(1H-imidazol-5-yl)prop-2-enoate;manganese(2+) |
| SMILES | O=C(O)c1ccccc1[O-].O=C([O-])C=Cc1cnc[nH]1.[Mn+2] |
| InChI | InChI=1S/C7H6O3.C6H6N2O2.Mn/c8-6-4-2-1-3-5(6)7(9)10;9-6(10)2-1-5-3-7-4-8-5;/h1-4,8H,(H,9,10);1-4H,(H,7,8)(H,9,10);/q;;+2/p-2 |
| InChIKey | UVBNQAICGAQIEL-UHFFFAOYSA-L |
| XLogP | -0.37 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|