C8H12N2O2 — CID 90887883
ethane;(E)-3-(1H-imidazol-5-yl)prop-2-enoic acid (PubChem CID 90887883) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is ethane;(E)-3-(1H-imidazol-5-yl)prop-2-enoic acid.
| Compound Name | ethane;(E)-3-(1H-imidazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 90887883 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | ethane;(E)-3-(1H-imidazol-5-yl)prop-2-enoic acid |
| SMILES | CC.O=C(O)/C=C/c1cnc[nH]1 |
| InChI | InChI=1S/C6H6N2O2.C2H6/c9-6(10)2-1-5-3-7-4-8-5;1-2/h1-4H,(H,7,8)(H,9,10);1-2H3/b2-1+; |
| InChIKey | LPYDLYZWLUZBIV-TYYBGVCCSA-N |
| XLogP | 1.53 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|