C12H17N3O6 — CID 68753228
2-aminohexanedioic acid;3-(1H-imidazol-5-yl)prop-2-enoic acid (PubChem CID 68753228) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-aminohexanedioic acid;3-(1H-imidazol-5-yl)prop-2-enoic acid.
| Compound Name | 2-aminohexanedioic acid;3-(1H-imidazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 68753228 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-aminohexanedioic acid;3-(1H-imidazol-5-yl)prop-2-enoic acid |
| SMILES | NC(CCCC(=O)O)C(=O)O.O=C(O)C=Cc1cnc[nH]1 |
| InChI | InChI=1S/C6H6N2O2.C6H11NO4/c9-6(10)2-1-5-3-7-4-8-5;7-4(6(10)11)2-1-3-5(8)9/h1-4H,(H,7,8)(H,9,10);4H,1-3,7H2,(H,8,9)(H,10,11) |
| InChIKey | UPOKIAWFBCYKKF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 166.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|