C12H10N2O9Zn2 — CID 67334141
dizinc;2-hydroxypropane-1,2,3-tricarboxylate;3-(1H-imidazol-5-yl)prop-2-enoate (PubChem CID 67334141) has the molecular formula C12H10N2O9Zn2 and a molecular weight of 457.00 g/mol. Its IUPAC name is dizinc;2-hydroxypropane-1,2,3-tricarboxylate;3-(1H-imidazol-5-yl)prop-2-enoate.
| Compound Name | dizinc;2-hydroxypropane-1,2,3-tricarboxylate;3-(1H-imidazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 67334141 |
| Molecular Formula | C12H10N2O9Zn2 |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 453.90 |
| IUPAC Name | dizinc;2-hydroxypropane-1,2,3-tricarboxylate;3-(1H-imidazol-5-yl)prop-2-enoate |
| SMILES | O=C([O-])C=Cc1cnc[nH]1.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C6H6N2O2.C6H8O7.2Zn/c9-6(10)2-1-5-3-7-4-8-5;7-3(8)1-6(13,5(11)12)2-4(9)10;;/h1-4H,(H,7,8)(H,9,10);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;;2*+2/p-4 |
| InChIKey | JPUGSUPTQBRLLT-UHFFFAOYSA-J |
| XLogP | -6.08 |
| TPSA | 209.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|