C7H11N5O — CID 137274384
1-ethyl-3-[(E)-1H-imidazol-5-ylmethylideneamino]urea (PubChem CID 137274384) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-1H-imidazol-5-ylmethylideneamino]urea.
| Compound Name | 1-ethyl-3-[(E)-1H-imidazol-5-ylmethylideneamino]urea |
|---|---|
| PubChem CID | 137274384 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 1-ethyl-3-[(E)-1H-imidazol-5-ylmethylideneamino]urea |
| SMILES | CCNC(=O)N/N=C/c1cnc[nH]1 |
| InChI | InChI=1S/C7H11N5O/c1-2-9-7(13)12-11-4-6-3-8-5-10-6/h3-5H,2H2,1H3,(H,8,10)(H2,9,12,13)/b11-4+ |
| InChIKey | ATUXQABYZZTLRX-NYYWCZLTSA-N |
| XLogP | 0.06 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|