C7H12N3OPS — CID 91572909
N-ethyl-2-(1H-imidazol-5-yl)acetamide;sulfanylidenephosphane (PubChem CID 91572909) has the molecular formula C7H12N3OPS and a molecular weight of 217.23 g/mol. Its IUPAC name is N-ethyl-2-(1H-imidazol-5-yl)acetamide;sulfanylidenephosphane.
| Compound Name | N-ethyl-2-(1H-imidazol-5-yl)acetamide;sulfanylidenephosphane |
|---|---|
| PubChem CID | 91572909 |
| Molecular Formula | C7H12N3OPS |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | N-ethyl-2-(1H-imidazol-5-yl)acetamide;sulfanylidenephosphane |
| SMILES | CCNC(=O)Cc1cnc[nH]1.P=S |
| InChI | InChI=1S/C7H11N3O.HPS/c1-2-9-7(11)3-6-4-8-5-10-6;1-2/h4-5H,2-3H2,1H3,(H,8,10)(H,9,11);1H |
| InChIKey | VDSRUXLNEXQJHQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|