C10H18N4O — CID 110684062
N-[3-(dimethylamino)propyl]-2-(1H-imidazol-5-yl)acetamide (PubChem CID 110684062) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110684062 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(1H-imidazol-5-yl)acetamide |
| SMILES | CN(C)CCCNC(=O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C10H18N4O/c1-14(2)5-3-4-12-10(15)6-9-7-11-8-13-9/h7-8H,3-6H2,1-2H3,(H,11,13)(H,12,15) |
| InChIKey | DRAMURFULTVQSU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|