About 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide
2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide (PubChem CID 166801161) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide |
| PubChem CID | 166801161 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(C(=O)N/N=C/c1cnc[nH]1)C(C)(C)C |
| InChI | InChI=1S/C15H26N4O/c1-14(2,3)7-12(15(4,5)6)13(20)19-18-9-11-8-16-10-17-11/h8-10,12H,7H2,1-6H3,(H,16,17)(H,19,20)/b18-9+ |
| InChIKey | AMFFBVYGLMTESM-GIJQJNRQSA-N |
| XLogP | 2.96 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide?
The IUPAC name of 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide (CID 166801161) is 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide.
What is the SMILES notation for 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide?
The canonical SMILES for 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide is CC(C)(C)CC(C(=O)N/N=C/c1cnc[nH]1)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide?
The InChIKey is AMFFBVYGLMTESM-GIJQJNRQSA-N. The full InChI is InChI=1S/C15H26N4O/c1-14(2,3)7-12(15(4,5)6)13(20)19-18-9-11-8-16-10-17-11/h8-10,12H,7H2,1-6H3,(H,16,17)(H,19,20)/b18-9+.
What are the key properties of 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide?
2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide has a molecular weight of 278.40 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[(E)-1H-imidazol-5-ylmethylideneamino]-4,4-dimethylpentanamide is sourced from PubChem (CID 166801161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).