C12H24N2O2 — CID 144616082
2-tert-butyl-N-carbamoyl-4,4-dimethylpentanamide (PubChem CID 144616082) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-tert-butyl-N-carbamoyl-4,4-dimethylpentanamide.
| Compound Name | 2-tert-butyl-N-carbamoyl-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 144616082 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-tert-butyl-N-carbamoyl-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(C(=O)NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-11(2,3)7-8(12(4,5)6)9(15)14-10(13)16/h8H,7H2,1-6H3,(H3,13,14,15,16) |
| InChIKey | QTCIMIAVTDZSNX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |