C15H30O — CID 157168171
4-tert-butyl-2,2,6,6-tetramethylheptan-3-one (PubChem CID 157168171) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 4-tert-butyl-2,2,6,6-tetramethylheptan-3-one.
| Compound Name | 4-tert-butyl-2,2,6,6-tetramethylheptan-3-one |
|---|---|
| PubChem CID | 157168171 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 4-tert-butyl-2,2,6,6-tetramethylheptan-3-one |
| SMILES | CC(C)(C)CC(C(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30O/c1-13(2,3)10-11(14(4,5)6)12(16)15(7,8)9/h11H,10H2,1-9H3 |
| InChIKey | UMKFLYOBLYWBDF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |