C14H29NO — CID 121265105
2-tert-butyl-4,4-dimethyl-N-propylpentanamide (PubChem CID 121265105) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-N-propylpentanamide.
| Compound Name | 2-tert-butyl-4,4-dimethyl-N-propylpentanamide |
|---|---|
| PubChem CID | 121265105 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-N-propylpentanamide |
| SMILES | CCCNC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-8-9-15-12(16)11(14(5,6)7)10-13(2,3)4/h11H,8-10H2,1-7H3,(H,15,16) |
| InChIKey | ZNWYKXQDCACRFP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |