C15H34N2O7P2 — CID 129124769
[2-[(2-tert-butyl-4,4-dimethylpentanoyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 129124769) has the molecular formula C15H34N2O7P2 and a molecular weight of 416.39 g/mol. Its IUPAC name is [2-[(2-tert-butyl-4,4-dimethylpentanoyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [2-[(2-tert-butyl-4,4-dimethylpentanoyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 129124769 |
| Molecular Formula | C15H34N2O7P2 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [2-[(2-tert-butyl-4,4-dimethylpentanoyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CC(C)(C)CC(C(=O)NCCN(CP(=O)(O)O)CP(=O)(O)O)C(C)(C)C |
| InChI | InChI=1S/C15H34N2O7P2/c1-14(2,3)9-12(15(4,5)6)13(18)16-7-8-17(10-25(19,20)21)11-26(22,23)24/h12H,7-11H2,1-6H3,(H,16,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | VSCNVISRZYIVME-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|