C11H18N2O7P2 — CID 13159891
[2-benzamidoethyl(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 13159891) has the molecular formula C11H18N2O7P2 and a molecular weight of 352.22 g/mol. Its IUPAC name is [2-benzamidoethyl(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [2-benzamidoethyl(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 13159891 |
| Molecular Formula | C11H18N2O7P2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [2-benzamidoethyl(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | O=C(NCCN(CP(=O)(O)O)CP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C11H18N2O7P2/c14-11(10-4-2-1-3-5-10)12-6-7-13(8-21(15,16)17)9-22(18,19)20/h1-5H,6-9H2,(H,12,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | CKDFXLMMROWYOS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|