C18H19N3O4 — CID 12052296
2-[bis(benzamidomethyl)amino]acetic acid (PubChem CID 12052296) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[bis(benzamidomethyl)amino]acetic acid.
| Compound Name | 2-[bis(benzamidomethyl)amino]acetic acid |
|---|---|
| PubChem CID | 12052296 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[bis(benzamidomethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CNC(=O)c1ccccc1)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O4/c22-16(23)11-21(12-19-17(24)14-7-3-1-4-8-14)13-20-18(25)15-9-5-2-6-10-15/h1-10H,11-13H2,(H,19,24)(H,20,25)(H,22,23) |
| InChIKey | UDEOOUHYZDXYPW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|