C17H21N2NaO10 — CID 174836558
sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;benzoate (PubChem CID 174836558) has the molecular formula C17H21N2NaO10 and a molecular weight of 436.35 g/mol. Its IUPAC name is sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;benzoate.
| Compound Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;benzoate |
|---|---|
| PubChem CID | 174836558 |
| Molecular Formula | C17H21N2NaO10 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;benzoate |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C10H16N2O8.C7H6O2.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;8-7(9)6-4-2-1-3-5-6;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | IFJUIEDYNCCCLU-UHFFFAOYSA-M |
| XLogP | -5.02 |
| TPSA | 195.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | -5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |