About sodium;formaldehyde;benzoate
sodium;formaldehyde;benzoate (PubChem CID 159976581) has the molecular formula C8H7NaO3
and a molecular weight of 174.13 g/mol. Its IUPAC name is sodium;formaldehyde;benzoate.
Molecular Properties
| Compound Name | sodium;formaldehyde;benzoate |
| PubChem CID | 159976581 |
| Molecular Formula | C8H7NaO3 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | sodium;formaldehyde;benzoate |
| SMILES | C=O.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H6O2.CH2O.Na/c8-7(9)6-4-2-1-3-5-6;1-2;/h1-5H,(H,8,9);1H2;/q;;+1/p-1 |
| InChIKey | OFFSZHBTUXHQJQ-UHFFFAOYSA-M |
| XLogP | -3.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;formaldehyde;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;formaldehyde;benzoate?
The IUPAC name of sodium;formaldehyde;benzoate (CID 159976581) is sodium;formaldehyde;benzoate.
What is the SMILES notation for sodium;formaldehyde;benzoate?
The canonical SMILES for sodium;formaldehyde;benzoate is C=O.O=C([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;formaldehyde;benzoate?
The InChIKey is OFFSZHBTUXHQJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O2.CH2O.Na/c8-7(9)6-4-2-1-3-5-6;1-2;/h1-5H,(H,8,9);1H2;/q;;+1/p-1.
What are the key properties of sodium;formaldehyde;benzoate?
sodium;formaldehyde;benzoate has a molecular weight of 174.13 g/mol, XLogP of -3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;formaldehyde;benzoate is sourced from PubChem (CID 159976581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).