C9H10FNO3 — CID 174760685
2-benzamidoacetic acid;hydrofluoride (PubChem CID 174760685) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 2-benzamidoacetic acid;hydrofluoride.
| Compound Name | 2-benzamidoacetic acid;hydrofluoride |
|---|---|
| PubChem CID | 174760685 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-benzamidoacetic acid;hydrofluoride |
| SMILES | F.O=C(O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO3.FH/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;/h1-5H,6H2,(H,10,13)(H,11,12);1H |
| InChIKey | SVDCZRNYCGZXFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |