C11H23FNO3P — CID 142069117
N-(2-tert-butyl-4,4-dimethylpentanoyl)-fluorophosphonamidic acid (PubChem CID 142069117) has the molecular formula C11H23FNO3P and a molecular weight of 267.28 g/mol. Its IUPAC name is N-(2-tert-butyl-4,4-dimethylpentanoyl)-fluorophosphonamidic acid.
| Compound Name | N-(2-tert-butyl-4,4-dimethylpentanoyl)-fluorophosphonamidic acid |
|---|---|
| PubChem CID | 142069117 |
| Molecular Formula | C11H23FNO3P |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(2-tert-butyl-4,4-dimethylpentanoyl)-fluorophosphonamidic acid |
| SMILES | CC(C)(C)CC(C(=O)NP(=O)(O)F)C(C)(C)C |
| InChI | InChI=1S/C11H23FNO3P/c1-10(2,3)7-8(11(4,5)6)9(14)13-17(12,15)16/h8H,7H2,1-6H3,(H2,13,14,15,16) |
| InChIKey | RSSNQYIECVKTIE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|