C11H25N3O — CID 174169742
N,N-diamino-2-tert-butyl-4,4-dimethylpentanamide (PubChem CID 174169742) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is N,N-diamino-2-tert-butyl-4,4-dimethylpentanamide.
| Compound Name | N,N-diamino-2-tert-butyl-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 174169742 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | N,N-diamino-2-tert-butyl-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(C(=O)N(N)N)C(C)(C)C |
| InChI | InChI=1S/C11H25N3O/c1-10(2,3)7-8(11(4,5)6)9(15)14(12)13/h8H,7,12-13H2,1-6H3 |
| InChIKey | CTEVBWXQZGTXNT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|