C15H26INO3 — CID 170127921
[(2-tert-butyl-4,4-dimethylpentanoyl)-iodoamino]methyl prop-2-enoate (PubChem CID 170127921) has the molecular formula C15H26INO3 and a molecular weight of 395.28 g/mol. Its IUPAC name is [(2-tert-butyl-4,4-dimethylpentanoyl)-iodoamino]methyl prop-2-enoate.
| Compound Name | [(2-tert-butyl-4,4-dimethylpentanoyl)-iodoamino]methyl prop-2-enoate |
|---|---|
| PubChem CID | 170127921 |
| Molecular Formula | C15H26INO3 |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(2-tert-butyl-4,4-dimethylpentanoyl)-iodoamino]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCN(I)C(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H26INO3/c1-8-12(18)20-10-17(16)13(19)11(15(5,6)7)9-14(2,3)4/h8,11H,1,9-10H2,2-7H3 |
| InChIKey | TYFZCHCNVSOPOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|