C14H33NO — CID 143641888
ethane;(2S)-2,3,3-trimethyl-N-propylbutanamide (PubChem CID 143641888) has the molecular formula C14H33NO and a molecular weight of 231.42 g/mol. Its IUPAC name is ethane;(2S)-2,3,3-trimethyl-N-propylbutanamide.
| Compound Name | ethane;(2S)-2,3,3-trimethyl-N-propylbutanamide |
|---|---|
| PubChem CID | 143641888 |
| Molecular Formula | C14H33NO |
| Molecular Weight | 231.42 g/mol |
| Exact Mass | 231.26 |
| IUPAC Name | ethane;(2S)-2,3,3-trimethyl-N-propylbutanamide |
| SMILES | CC.CC.CCCNC(=O)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO.2C2H6/c1-6-7-11-9(12)8(2)10(3,4)5;2*1-2/h8H,6-7H2,1-5H3,(H,11,12);2*1-2H3/t8-;;/m1../s1 |
| InChIKey | GSMPTGFTQJQQBS-YCBDHFTFSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |