C9H18N2O2 — CID 143641947
N-(2-amino-2-oxoethyl)-2,3,3-trimethylbutanamide (PubChem CID 143641947) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,3,3-trimethylbutanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 143641947 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,3,3-trimethylbutanamide |
| SMILES | CC(C(=O)NCC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-6(9(2,3)4)8(13)11-5-7(10)12/h6H,5H2,1-4H3,(H2,10,12)(H,11,13) |
| InChIKey | HBCVLEAPFCUGKN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |