C17H31NO — CID 143855700
benzene;ethane;N-ethyl-2,3,3-trimethylbutanamide (PubChem CID 143855700) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is benzene;ethane;N-ethyl-2,3,3-trimethylbutanamide.
| Compound Name | benzene;ethane;N-ethyl-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 143855700 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | benzene;ethane;N-ethyl-2,3,3-trimethylbutanamide |
| SMILES | CC.CCNC(=O)C(C)C(C)(C)C.c1ccccc1 |
| InChI | InChI=1S/C9H19NO.C6H6.C2H6/c1-6-10-8(11)7(2)9(3,4)5;1-2-4-6-5-3-1;1-2/h7H,6H2,1-5H3,(H,10,11);1-6H;1-2H3 |
| InChIKey | OWXFNVAZESBPQQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |