C12H27N3O2 — CID 143855257
N-[2-(carbamoylamino)ethyl]-2,3,3-trimethylbutanamide;ethane (PubChem CID 143855257) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2,3,3-trimethylbutanamide;ethane.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2,3,3-trimethylbutanamide;ethane |
|---|---|
| PubChem CID | 143855257 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2,3,3-trimethylbutanamide;ethane |
| SMILES | CC.CC(C(=O)NCCNC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C10H21N3O2.C2H6/c1-7(10(2,3)4)8(14)12-5-6-13-9(11)15;1-2/h7H,5-6H2,1-4H3,(H,12,14)(H3,11,13,15);1-2H3 |
| InChIKey | NWIZOALJSCUHKD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|