C11H23N3O2 — CID 143855436
N-[2-(carbamoylamino)ethyl]-N,2,3,3-tetramethylbutanamide (PubChem CID 143855436) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-N,2,3,3-tetramethylbutanamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-N,2,3,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 143855436 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-N,2,3,3-tetramethylbutanamide |
| SMILES | CC(C(=O)N(C)CCNC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C11H23N3O2/c1-8(11(2,3)4)9(15)14(5)7-6-13-10(12)16/h8H,6-7H2,1-5H3,(H3,12,13,16) |
| InChIKey | WOGOLUPKPQVTDG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |